CAS 92961-15-4 appears in our catalog under these names: 3-Phenylimidazo[1,2-a]pyridine, 95%, 3–Phenylimidazo(1,2–a)pyridine, 3-PHENYLIMIDAZO[1,2-A]PYRIDINE, 97%, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
3-phenylimidazo[1,2-a]pyridine (CAS 92961-15-4) is a chemical compound with the molecular formula C13H10N2 and a molecular weight of 194.23 g/mol. IUPAC name: 3-phenylimidazo[1,2-a]pyridine. InChIKey: AFWDAKKJDBULCR-UHFFFAOYSA-N.
| Molecular formula | C13H10N2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 3-phenylimidazo[1,2-a]pyridine |
| InChIKey | AFWDAKKJDBULCR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C3N2C=CC=C3 |
Computed by PubChem (NCBI)