CAS 581-28-2 is the registry number for Acridin-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
Acridin-2-amine (CAS 581-28-2) is a chemical compound with the molecular formula C13H10N2 and a molecular weight of 194.23 g/mol. IUPAC name: acridin-2-amine. InChIKey: UTXPWBKKZFLMPZ-UHFFFAOYSA-N.
| Molecular formula | C13H10N2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | acridin-2-amine |
| InChIKey | UTXPWBKKZFLMPZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C3C=C(C=CC3=N2)N |
Computed by PubChem (NCBI)