CAS 25797-03-9 appears in our catalog under these names: 2-Phenyl-4-azaindole, 95%, 2–Phenyl–1H–pyrrolo(3,2–b)pyridine, 2-Phenyl-4-azaindole, 95%, 95%, 2-Phenyl-1H-pyrrolo[3,2-b]pyridine, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 100mg.
2-phenyl-1H-pyrrolo[3,2-b]pyridine (CAS 25797-03-9) is a chemical compound with the molecular formula C13H10N2 and a molecular weight of 194.23 g/mol. IUPAC name: 2-phenyl-1H-pyrrolo[3,2-b]pyridine. InChIKey: MHTVGGZESFVQIQ-UHFFFAOYSA-N.
| Molecular formula | C13H10N2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 2-phenyl-1H-pyrrolo[3,2-b]pyridine |
| InChIKey | MHTVGGZESFVQIQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(N2)C=CC=N3 |
Computed by PubChem (NCBI)