cas: 3419-91-8 — see every product listed under this CAS number, including other names
1-Pyridin-2-yl-1H-indole, 95-<97% (CAS 3419-91-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 50g, 100g, 200g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC6689-95-97-25g |
| cas | 3419-91-8 |
| size | 25g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 25g | 8735.98 Pln | |
| Hoffman Fine Chemicals | 50g | 13795.32 Pln | |
| Hoffman Fine Chemicals | 100g | 21885.16 Pln | |
| Hoffman Fine Chemicals | 200g | 34830.18 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
1-pyridin-2-ylindole (CAS 3419-91-8) is a chemical compound with the molecular formula C13H10N2 and a molecular weight of 194.23 g/mol. IUPAC name: 1-pyridin-2-ylindole. InChIKey: VSKZGHVPGOMFAV-UHFFFAOYSA-N.
| Molecular formula | C13H10N2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 1-pyridin-2-ylindole |
| InChIKey | VSKZGHVPGOMFAV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CN2C3=CC=CC=N3 |
Computed by PubChem (NCBI)