cas: 138423-86-6 — see every product listed under this CAS number, including other names
1-TERT-BUTYL 2-METHYL (2S)-4,4-DIMETHYLPYRROLIDINE-1,2-DICARBOXYLATE, 95% (CAS 138423-86-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F816838-100MG |
| cas | 138423-86-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 476.93 Pln | |
| Fluorochem | 250mg | 581.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1-O-tert-butyl 2-O-methyl (2S)-4,4-dimethylpyrrolidine-1,2-dicarboxylate (CAS 138423-86-6) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S)-4,4-dimethylpyrrolidine-1,2-dicarboxylate. InChIKey: YSKUQLCATBOEBJ-VIFPVBQESA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S)-4,4-dimethylpyrrolidine-1,2-dicarboxylate |
| InChIKey | YSKUQLCATBOEBJ-VIFPVBQESA-N |
| SMILES | CC1(C[C@H](N(C1)C(=O)OC(C)(C)C)C(=O)OC)C |
Computed by PubChem (NCBI)