CAS 138423-86-6 appears in our catalog under these names: (S)-1-tert-Butyl 2-methyl 4,4-dimethylpyrrolidine-1,2-dicarboxylate, 95%, (S)-1-tert-Butyl 2-methyl 4,4-dimethylpyrrolidine-1,2-dicarboxylate, 97%, (S)–1–tert–Butyl 2–methyl 4,4–dimethylpyrrolidine–1,2–dicarboxylate, (S)-1-tert-Butyl 2-methyl 4,4-dimethylpyrrolidine-1,2-dicarboxylate, 97%, 97%, 1-TERT-BUTYL 2-METHYL (2S)-4,4-DIMETHYLPYRROLIDINE-1,2-DICARBOXYLATE, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g, 500mg.
1-O-tert-butyl 2-O-methyl (2S)-4,4-dimethylpyrrolidine-1,2-dicarboxylate (CAS 138423-86-6) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S)-4,4-dimethylpyrrolidine-1,2-dicarboxylate. InChIKey: YSKUQLCATBOEBJ-VIFPVBQESA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S)-4,4-dimethylpyrrolidine-1,2-dicarboxylate |
| InChIKey | YSKUQLCATBOEBJ-VIFPVBQESA-N |
| SMILES | CC1(C[C@H](N(C1)C(=O)OC(C)(C)C)C(=O)OC)C |
Computed by PubChem (NCBI)