CAS 327156-95-6 appears in our catalog under these names: Boc-cis-1,4-aminocyclohexyl acetic acid, 95%, cis–(4–(Boc–amino)cyclohexyl)acetic acid, Boc-1,4-cis-ACHA-OH, Boc-cis-4-aminocyclohexane acetic acid, 97%, 97%, 2-(cis-4-((tert-Butoxycarbonyl)amino)cyclohexyl)acetic acid, 98.0%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Chemat, MedChemExpress. Available pack sizes: 1g, 10g, 25g, 5g, 250mg, 100mg, 250 mg, 10 g.
2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]acetic acid (CAS 327156-95-6) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]acetic acid. InChIKey: IHXBNSUFUFFBRL-UHFFFAOYSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]acetic acid |
| InChIKey | IHXBNSUFUFFBRL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCC(CC1)CC(=O)O |
Computed by PubChem (NCBI)