CAS 1445951-75-6 is the registry number for Racemic-(3r,5s)-tert-butyl 3-hydroxy-1-oxa-7-azaspiro[4.5]decane-7-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl (3R,5S)-3-hydroxy-1-oxa-9-azaspiro[4.5]decane-9-carboxylate (CAS 1445951-75-6) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: tert-butyl (3R,5S)-3-hydroxy-1-oxa-9-azaspiro[4.5]decane-9-carboxylate. InChIKey: LILGESIHSOUCBM-MFKMUULPSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | tert-butyl (3R,5S)-3-hydroxy-1-oxa-9-azaspiro[4.5]decane-9-carboxylate |
| InChIKey | LILGESIHSOUCBM-MFKMUULPSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@]2(C1)C[C@H](CO2)O |
Computed by PubChem (NCBI)