CAS 162046-58-4 appears in our catalog under these names: Boc-4-Amc-OH, 98%, Boc-4-Amc-OH, 98%, 98%, 4-(((tert-Butoxycarbonyl)amino)methyl)cyclohexanecarboxylic acid, 98%, 4-(([(tert-Butoxy)carbonyl]amino)methyl)cyclohexane-1-carboxylic acid, 97%, Boc-tranexamic acid. Offered by: AmBeed, Chemat, Fluorochem, Combi-blocks, Biosynth. Available pack sizes: 25g, 1g, 100mg, 250mg, 5g, 25 g, 10 g, 500 mg.
4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexane-1-carboxylic acid (CAS 162046-58-4) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: 4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexane-1-carboxylic acid. InChIKey: AZEKNJGFCSHZID-UHFFFAOYSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | 4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexane-1-carboxylic acid |
| InChIKey | AZEKNJGFCSHZID-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1CCC(CC1)C(=O)O |
Computed by PubChem (NCBI)