CAS 1335031-50-9 is the registry number for Cis-2-tert-butoxycarbonylamino-2-methyl-cyclohexanecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
Cis-(1R,2S)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid (CAS 1335031-50-9) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: cis-(1R,2S)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid. InChIKey: LSHSJLZEFNANGN-ZANVPECISA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | cis-(1R,2S)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid |
| InChIKey | LSHSJLZEFNANGN-ZANVPECISA-N |
| SMILES | C[C@@]1(CCCC[C@H]1C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)