CAS 495415-08-2 appears in our catalog under these names: 1-tert-Butyl 4-methyl 4-methoxypiperidine-1,4-dicarboxylate, 95%, 1-tert-butyl 4-methyl 4-methoxypiperidine-1,4-dicarboxylate, 97%, 97%, 1-tert-Butyl 4-methyl 4-methoxypiperidine-1,4-dicarboxylate, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg.
1-O-tert-butyl 4-O-methyl 4-methoxypiperidine-1,4-dicarboxylate (CAS 495415-08-2) is a chemical compound with the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. IUPAC name: 1-O-tert-butyl 4-O-methyl 4-methoxypiperidine-1,4-dicarboxylate. InChIKey: MPSOCQILFQVTCO-UHFFFAOYSA-N.
| Molecular formula | C13H23NO5 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-methyl 4-methoxypiperidine-1,4-dicarboxylate |
| InChIKey | MPSOCQILFQVTCO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(C(=O)OC)OC |
Computed by PubChem (NCBI)