1-TOSYLAZETIDIN-3-OL, 95+%
cas: 154010-96-5 — see every product listed under this CAS number, including other names
1-TOSYLAZETIDIN-3-OL, 95+% (CAS 154010-96-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F501760-100MG |
| cas | 154010-96-5 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 648.75 Pln | |
| Fluorochem | 250mg | 1049.65 Pln | |
| Fluorochem | 1g | 2674.08 Pln | |
| Fluorochem | 5g | 8890.64 Pln | |
| Ambeed | 100mg | 420.44 Pln | |
| Ambeed | 250mg | 492.75 Pln | |
| Ambeed | 1g | 1338.25 Pln | |
| Ambeed | 5g | 3880.31 Pln | |
| Chemat | 100mg | 453.20 Pln | |
| Chemat | 250mg | 726.80 Pln | |
| Chemat | 1g | 1850.00 Pln | |
| Chemat | 5g | 6323.60 Pln | |
| Chemat | 10g | 10077.20 Pln |
properties
| purity | 95+% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
1-(4-methylphenyl)sulfonylazetidin-3-ol (CAS 154010-96-5) is a chemical compound with the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonylazetidin-3-ol. InChIKey: GDXKSMNNDKYNMK-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3S |
|---|---|
| Molecular weight | 227.28 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonylazetidin-3-ol |
| InChIKey | GDXKSMNNDKYNMK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CC(C2)O |
Computed by PubChem (NCBI)