CAS 103661-13-8 appears in our catalog under these names: 4-(4-Hydroxyphenyl)thiomorpholine 1,1-dioxide, 95%, 4–(4–Hydroxyphenyl)thiomorpholine 1,1–Dioxide, 4-(4-Hydroxyphenyl)thiomorpholine 1,1-Dioxide, >98.0%(GC)(T), 4-(4-Hydroxyphenyl)thiomorpholine 1,1-Dioxide, 98.0%, 98.0%. Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 10g, 1g, 5g.
4-(1,1-dioxo-1,4-thiazinan-4-yl)phenol (CAS 103661-13-8) is a chemical compound with the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. IUPAC name: 4-(1,1-dioxo-1,4-thiazinan-4-yl)phenol. InChIKey: NSHOLIWPDBJMPT-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3S |
|---|---|
| Molecular weight | 227.28 g/mol |
| IUPAC name | 4-(1,1-dioxo-1,4-thiazinan-4-yl)phenol |
| InChIKey | NSHOLIWPDBJMPT-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCN1C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)