CAS 154010-96-5 appears in our catalog under these names: 1-Tosylazetidin-3-ol, 95%, 1-Tosylazetidin-3-ol, 95+%, 95+%, 1-TOSYLAZETIDIN-3-OL, 95+%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
1-(4-methylphenyl)sulfonylazetidin-3-ol (CAS 154010-96-5) is a chemical compound with the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonylazetidin-3-ol. InChIKey: GDXKSMNNDKYNMK-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3S |
|---|---|
| Molecular weight | 227.28 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonylazetidin-3-ol |
| InChIKey | GDXKSMNNDKYNMK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CC(C2)O |
Computed by PubChem (NCBI)