CAS 117642-16-7 appears in our catalog under these names: Ethyl 2-amino-4H,5H,7H-thieno[2,3-c]pyran-3-carboxylate, 98%, Ethyl 2–amino–4H,5H,7H–thieno(2,3–c)pyran–3–carboxylate, Ethyl 2-amino-4,7-dihydro-5H-thieno(2,3-c)pyran-3-carboxylate, Ethyl 2-amino-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylate 98%, Ethyl 2-amino-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylate, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 10g, 25g, 5g, 250mg, 2,5g, 100mg.
Ethyl 2-amino-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylate (CAS 117642-16-7) is a chemical compound with the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. IUPAC name: ethyl 2-amino-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylate. InChIKey: RRKGPBYCHQFJEG-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3S |
|---|---|
| Molecular weight | 227.28 g/mol |
| IUPAC name | ethyl 2-amino-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylate |
| InChIKey | RRKGPBYCHQFJEG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC2=C1CCOC2)N |
Computed by PubChem (NCBI)