Products 870860-34-7

CAS 870860-34-7 is the registry number for Morpholin-4-yl-thiophen-2-yl-acetic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-morpholin-4-yl-2-thiophen-2-ylacetic acid (CAS 870860-34-7) is a chemical compound with the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. IUPAC name: 2-morpholin-4-yl-2-thiophen-2-ylacetic acid. InChIKey: UUCFFFMUBSIDDV-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13NO3S
Molecular weight227.28 g/mol
IUPAC name2-morpholin-4-yl-2-thiophen-2-ylacetic acid
InChIKeyUUCFFFMUBSIDDV-UHFFFAOYSA-N
SMILESC1COCCN1C(C2=CC=CS2)C(=O)O

Computed by PubChem (NCBI)