CAS 157187-16-1 is the registry number for 4-(1-Pyrrolidinylsulfonyl)-phenol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
4-pyrrolidin-1-ylsulfonylphenol (CAS 157187-16-1) is a chemical compound with the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. IUPAC name: 4-pyrrolidin-1-ylsulfonylphenol. InChIKey: MISYZISDEPUMMN-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3S |
|---|---|
| Molecular weight | 227.28 g/mol |
| IUPAC name | 4-pyrrolidin-1-ylsulfonylphenol |
| InChIKey | MISYZISDEPUMMN-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)S(=O)(=O)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)