cas: 154010-96-5 — see every product listed under this CAS number, including other names
1-Tosylazetidin-3-ol, 95+%, 95+% (CAS 154010-96-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ADZD-100mg |
| cas | 154010-96-5 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 390.80 Pln | |
| Chemat | 250mg | 616.40 Pln | |
| Chemat | 1g | 1562.00 Pln | |
| Chemat | 5g | 5306.00 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
1-(4-methylphenyl)sulfonylazetidin-3-ol (CAS 154010-96-5) is a chemical compound with the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonylazetidin-3-ol. InChIKey: GDXKSMNNDKYNMK-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3S |
|---|---|
| Molecular weight | 227.28 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonylazetidin-3-ol |
| InChIKey | GDXKSMNNDKYNMK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CC(C2)O |
Computed by PubChem (NCBI)