cas: 3634-89-7 — see every product listed under this CAS number, including other names
1-Tosylaziridine, >98.0%(HPLC)(qNMR) (CAS 3634-89-7) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T4289-200MG |
| cas | 3634-89-7 |
| size | 200mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 200mg | 296.86 Pln | |
| TCI | 1g | 577.14 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(qNMR) |
1-(4-methylphenyl)sulfonylaziridine (CAS 3634-89-7) is a chemical compound with the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonylaziridine. InChIKey: VBNWSEVVMYMVLC-UHFFFAOYSA-N.
| Molecular formula | C9H11NO2S |
|---|---|
| Molecular weight | 197.26 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonylaziridine |
| InChIKey | VBNWSEVVMYMVLC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CC2 |
Computed by PubChem (NCBI)