cas: 3634-89-7 — see every product listed under this CAS number, including other names
1-Tosylaziridine, 95% (CAS 3634-89-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F791386-1G |
| cas | 3634-89-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 5g | 450.90 Pln | |
| Fluorochem | 10g | 841.39 Pln | |
| Fluorochem | 25g | 1476.58 Pln | |
| Fluorochem | 100g | 4777.50 Pln | |
| Fluorochem | 500g | 18928.77 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
1-(4-methylphenyl)sulfonylaziridine (CAS 3634-89-7) is a chemical compound with the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonylaziridine. InChIKey: VBNWSEVVMYMVLC-UHFFFAOYSA-N.
| Molecular formula | C9H11NO2S |
|---|---|
| Molecular weight | 197.26 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonylaziridine |
| InChIKey | VBNWSEVVMYMVLC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CC2 |
Computed by PubChem (NCBI)