1-methyl-1H-indazole-3-carboxamide, 97%
cas: 129137-93-5 — see every product listed under this CAS number, including other names
1-methyl-1H-indazole-3-carboxamide, 97% (CAS 129137-93-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch110CPE-100mg |
| cas | 129137-93-5 |
| size | 100mg |
| availability | 25g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 342.80 Pln | |
| Chemat | 250mg | 434.00 Pln | |
| Chemat | 500mg | 693.20 Pln | |
| Chemat | 1g | 990.80 Pln | |
| Chemat | 5g | 2896.40 Pln | |
| Chemat | 10g | 4797.20 Pln | |
| Chemat | 25g | 9530.00 Pln | |
| Fluorochem | 100mg | 617.51 Pln | |
| Fluorochem | 250mg | 789.32 Pln | |
| Fluorochem | 500mg | 1278.73 Pln | |
| Fluorochem | 1g | 1830.62 Pln | |
| Fluorochem | 5g | 5365.84 Pln | |
| Fluorochem | 10g | 8739.65 Pln | |
| Fluorochem | 25g | 17398.06 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-methylindazole-3-carboxamide (CAS 129137-93-5) is a chemical compound with the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. IUPAC name: 1-methylindazole-3-carboxamide. InChIKey: PVROETJHCUDAFG-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O |
|---|---|
| Molecular weight | 175.19 g/mol |
| IUPAC name | 1-methylindazole-3-carboxamide |
| InChIKey | PVROETJHCUDAFG-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C(=N1)C(=O)N |
Computed by PubChem (NCBI)