cas: 1011479-75-6 — see every product listed under this CAS number, including other names
1-tert-Butyl 3,3-diethyl azetidine-1,3,3-tricarboxylate 95% (CAS 1011479-75-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A540841-100mg |
| cas | 1011479-75-6 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 214.62 Pln | |
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 448.25 Pln | |
| Ambeed | 5g | 1221.44 Pln | |
| Ambeed | 10g | 2089.19 Pln | |
| Ambeed | 25g | 4102.81 Pln | |
| Ambeed | 100g | 12975.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A540841 |
1-O-tert-butyl 3-O,3-O'-diethyl azetidine-1,3,3-tricarboxylate (CAS 1011479-75-6) is a chemical compound with the molecular formula C14H23NO6 and a molecular weight of 301.34 g/mol. IUPAC name: 1-O-tert-butyl 3-O,3-O'-diethyl azetidine-1,3,3-tricarboxylate. InChIKey: FYUPJGXEWFMXHW-UHFFFAOYSA-N.
| Molecular formula | C14H23NO6 |
|---|---|
| Molecular weight | 301.34 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O,3-O'-diethyl azetidine-1,3,3-tricarboxylate |
| InChIKey | FYUPJGXEWFMXHW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CN(C1)C(=O)OC(C)(C)C)C(=O)OCC |
Computed by PubChem (NCBI)