Products 595555-70-7

CAS 595555-70-7 is the registry number for 1-tert-Butyl 3,5-dimethyl piperidine-1,3,5-tricarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 3-O,5-O-dimethyl piperidine-1,3,5-tricarboxylate (CAS 595555-70-7) is a chemical compound with the molecular formula C14H23NO6 and a molecular weight of 301.34 g/mol. IUPAC name: 1-O-tert-butyl 3-O,5-O-dimethyl piperidine-1,3,5-tricarboxylate. InChIKey: MIZBOYNXOLJHQY-UHFFFAOYSA-N.

Identity
Molecular formulaC14H23NO6
Molecular weight301.34 g/mol
IUPAC name1-O-tert-butyl 3-O,5-O-dimethyl piperidine-1,3,5-tricarboxylate
InChIKeyMIZBOYNXOLJHQY-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CC(CC(C1)C(=O)OC)C(=O)OC

Computed by PubChem (NCBI)