CAS 71447-58-0 appears in our catalog under these names: Boc-Asp(ocpent)-OH, 98%, (S)-2-((tert-Butoxycarbonyl)amino)-4-(cyclopentyloxy)-4-oxobutanoic acid, 98%, Boc–Asp(OcPent)–OH. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 25g, 100g, 5g, 1g.
(2S)-4-cyclopentyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid (CAS 71447-58-0) is a chemical compound with the molecular formula C14H23NO6 and a molecular weight of 301.34 g/mol. IUPAC name: (2S)-4-cyclopentyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid. InChIKey: KZNUOIDFRKKMRF-JTQLQIEISA-N.
| Molecular formula | C14H23NO6 |
|---|---|
| Molecular weight | 301.34 g/mol |
| IUPAC name | (2S)-4-cyclopentyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid |
| InChIKey | KZNUOIDFRKKMRF-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)OC1CCCC1)C(=O)O |
Computed by PubChem (NCBI)