Products 911050-47-0
CAS 911050-47-0 is the registry number for tert-Butyl (R)-(1-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)propan-2-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(2R)-1-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)propan-2-yl]carbamate (CAS 911050-47-0) is a chemical compound with the molecular formula C14H23NO6 and a molecular weight of 301.34 g/mol. IUPAC name: tert-butyl N-[(2R)-1-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)propan-2-yl]carbamate. InChIKey: WWYAYRUBKBNMFQ-MRVPVSSYSA-N.
| Molecular formula | C14H23NO6 |
|---|---|
| Molecular weight | 301.34 g/mol |
| IUPAC name | tert-butyl N-[(2R)-1-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)propan-2-yl]carbamate |
| InChIKey | WWYAYRUBKBNMFQ-MRVPVSSYSA-N |
| SMILES | C[C@H](CC1C(=O)OC(OC1=O)(C)C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)