Products 157226-76-1
CAS 157226-76-1 is the registry number for Rel-(3R,5S)-1-tert-Butyl 3,5-dimethyl piperidine-1,3,5-tricarboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-O-tert-butyl 3-O,5-O-dimethyl (3S,5R)-piperidine-1,3,5-tricarboxylate (CAS 157226-76-1) is a chemical compound with the molecular formula C14H23NO6 and a molecular weight of 301.34 g/mol. IUPAC name: 1-O-tert-butyl 3-O,5-O-dimethyl (3S,5R)-piperidine-1,3,5-tricarboxylate. InChIKey: MIZBOYNXOLJHQY-AOOOYVTPSA-N.
| Molecular formula | C14H23NO6 |
|---|---|
| Molecular weight | 301.34 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O,5-O-dimethyl (3S,5R)-piperidine-1,3,5-tricarboxylate |
| InChIKey | MIZBOYNXOLJHQY-AOOOYVTPSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@@H](C1)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)