Products 2816820-24-1

CAS 2816820-24-1 is the registry number for O1-tert-butyl O3,O4-dimethyl trans-piperidine-1,3,4-tricarboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 3-O,4-O-dimethyl (3R,4S)-piperidine-1,3,4-tricarboxylate (CAS 2816820-24-1) is a chemical compound with the molecular formula C14H23NO6 and a molecular weight of 301.34 g/mol. IUPAC name: 1-O-tert-butyl 3-O,4-O-dimethyl (3R,4S)-piperidine-1,3,4-tricarboxylate. InChIKey: LVWCBPHCEJNKJG-UWVGGRQHSA-N.

Identity
Molecular formulaC14H23NO6
Molecular weight301.34 g/mol
IUPAC name1-O-tert-butyl 3-O,4-O-dimethyl (3R,4S)-piperidine-1,3,4-tricarboxylate
InChIKeyLVWCBPHCEJNKJG-UWVGGRQHSA-N
SMILESCC(C)(C)OC(=O)N1CC[C@@H]([C@H](C1)C(=O)OC)C(=O)OC

Computed by PubChem (NCBI)