cas: 376387-68-7 — see every product listed under this CAS number, including other names
1-tert-Butyl-5-methyl-1H-pyrazole-3-carboxylic acid, 97% (CAS 376387-68-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 2.5g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F075739-1G |
| cas | 376387-68-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 289.50 Pln | |
| Fluorochem | 2.5g | 638.33 Pln | |
| Fluorochem | 5g | 1221.46 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
1-tert-butyl-5-methylpyrazole-3-carboxylic acid (CAS 376387-68-7) is a chemical compound with the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. IUPAC name: 1-tert-butyl-5-methylpyrazole-3-carboxylic acid. InChIKey: FCFGJNOOQYQMKY-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O2 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 1-tert-butyl-5-methylpyrazole-3-carboxylic acid |
| InChIKey | FCFGJNOOQYQMKY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)