cas: 1239355-46-4 — see every product listed under this CAS number, including other names
1-tert-butyl 2-methyl (2R)-aziridine-1,2-dicarboxylate, 97% (CAS 1239355-46-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F874239-100MG |
| cas | 1239355-46-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 143.72 Pln | |
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 419.66 Pln | |
| Fluorochem | 5g | 1861.86 Pln | |
| Fluorochem | 25g | 6391.52 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
1-O-tert-butyl 2-O-methyl (2R)-aziridine-1,2-dicarboxylate (CAS 1239355-46-4) is a chemical compound with the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2R)-aziridine-1,2-dicarboxylate. InChIKey: OHKDZMSOHBQKDL-ZMMDDIOLSA-N.
| Molecular formula | C9H15NO4 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2R)-aziridine-1,2-dicarboxylate |
| InChIKey | OHKDZMSOHBQKDL-ZMMDDIOLSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]1C(=O)OC |
Computed by PubChem (NCBI)