CAS 126496-79-5 appears in our catalog under these names: 1–(tert–Butyl) 2–methyl (S)–aziridine–1,2–dicarboxylate, (S)-1-tert-Butyl 2-methyl aziridine-1,2-dicarboxylate, 1-(tert-Butyl) 2-methyl (S)-aziridine-1,2-dicarboxylate, 95%, 95%, (S)-1-tert-Butyl 2-methyl aziridine-1,2-dicarboxylate, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 2g, 250mg, 1g, 25g, 500mg, 5g, 10g.
1-O-tert-butyl 2-O-methyl (2S)-aziridine-1,2-dicarboxylate (CAS 126496-79-5) is a chemical compound with the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S)-aziridine-1,2-dicarboxylate. InChIKey: OHKDZMSOHBQKDL-UOQJWNSWSA-N.
| Molecular formula | C9H15NO4 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S)-aziridine-1,2-dicarboxylate |
| InChIKey | OHKDZMSOHBQKDL-UOQJWNSWSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]1C(=O)OC |
Computed by PubChem (NCBI)