CAS 181212-90-8 appears in our catalog under these names: 1–tert–Butyl 2–methyl aziridine–1,2–dicarboxylate, Methyl 1-Boc-Aziridine-2-Carboxylate, 98%, 98%, 1-tert-Butyl 2-methyl aziridine-1,2-dicarboxylate, 96%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 500mg, 1g, 5g, 10g, 25g.
1-O-tert-butyl 2-O-methyl aziridine-1,2-dicarboxylate (CAS 181212-90-8) is a chemical compound with the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl aziridine-1,2-dicarboxylate. InChIKey: OHKDZMSOHBQKDL-UHFFFAOYSA-N.
| Molecular formula | C9H15NO4 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl aziridine-1,2-dicarboxylate |
| InChIKey | OHKDZMSOHBQKDL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC1C(=O)OC |
Computed by PubChem (NCBI)