cas: 4014-77-1 — see every product listed under this CAS number, including other names
10,11-Dihydro-5H-dibenzo[b,f]azepin-10-ol, 98% (CAS 4014-77-1) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F234904-25MG |
| cas | 4014-77-1 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25mg | 622.72 Pln | |
| Fluorochem | 100mg | 1382.86 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
6,11-dihydro-5H-benzo[b][1]benzazepin-5-ol (CAS 4014-77-1) is a chemical compound with the molecular formula C14H13NO and a molecular weight of 211.26 g/mol. IUPAC name: 6,11-dihydro-5H-benzo[b][1]benzazepin-5-ol. InChIKey: NPKCAMZGRRHFTJ-UHFFFAOYSA-N.
| Molecular formula | C14H13NO |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | 6,11-dihydro-5H-benzo[b][1]benzazepin-5-ol |
| InChIKey | NPKCAMZGRRHFTJ-UHFFFAOYSA-N |
| SMILES | C1C(C2=CC=CC=C2NC3=CC=CC=C31)O |
Computed by PubChem (NCBI)