cas: 1425485-72-8 — see every product listed under this CAS number, including other names
11,12-Didehydro-ε-oxodibenz[b,f]azocine-5(6H)-hexanoic acid, 97%, 97% (CAS 1425485-72-8) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HWII-25mg |
| cas | 1425485-72-8 |
| size | 25mg |
| availability | 150g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 261.20 Pln | |
| Chemat | 50mg | 280.40 Pln | |
| Chemat | 100mg | 347.60 Pln | |
| Chemat | 250mg | 486.80 Pln | |
| Chemat | 1g | 1274.00 Pln | |
| Chemat | 5g | 4902.80 Pln | |
| Chemat | 10g | 8296.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxohexanoic acid (CAS 1425485-72-8) is a chemical compound with the molecular formula C21H19NO3 and a molecular weight of 333.4 g/mol. IUPAC name: 6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxohexanoic acid. InChIKey: NIRLBCOFKPVQLM-UHFFFAOYSA-N.
| Molecular formula | C21H19NO3 |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | 6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxohexanoic acid |
| InChIKey | NIRLBCOFKPVQLM-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C#CC3=CC=CC=C3N1C(=O)CCCCC(=O)O |
Computed by PubChem (NCBI)