CAS 1024250-49-4 is the registry number for 2-(((4-acetylphenyl)amino)methylene)-5-phenylcyclohexane-1,3-dione. Offered by: Biosynth. Available pack sizes: 250mg.
2-[(4-acetylphenyl)iminomethyl]-3-hydroxy-5-phenylcyclohex-2-en-1-one (CAS 1024250-49-4) is a chemical compound with the molecular formula C21H19NO3 and a molecular weight of 333.4 g/mol. IUPAC name: 2-[(4-acetylphenyl)iminomethyl]-3-hydroxy-5-phenylcyclohex-2-en-1-one. InChIKey: STDSKYZJCXUSPT-UHFFFAOYSA-N.
| Molecular formula | C21H19NO3 |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | 2-[(4-acetylphenyl)iminomethyl]-3-hydroxy-5-phenylcyclohex-2-en-1-one |
| InChIKey | STDSKYZJCXUSPT-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)N=CC2=C(CC(CC2=O)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)