Products 2305668-80-6
CAS 2305668-80-6 is the registry number for Microtubule inhibitor 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-3-(3-hydroxy-4-methoxyphenyl)-2-methyl-1-(2-methylquinolin-4-yl)prop-2-en-1-one (CAS 2305668-80-6) is a chemical compound with the molecular formula C21H19NO3 and a molecular weight of 333.4 g/mol. IUPAC name: (E)-3-(3-hydroxy-4-methoxyphenyl)-2-methyl-1-(2-methylquinolin-4-yl)prop-2-en-1-one. InChIKey: CZORMYBDJDSAFW-JLHYYAGUSA-N.
| Molecular formula | C21H19NO3 |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | (E)-3-(3-hydroxy-4-methoxyphenyl)-2-methyl-1-(2-methylquinolin-4-yl)prop-2-en-1-one |
| InChIKey | CZORMYBDJDSAFW-JLHYYAGUSA-N |
| SMILES | CC1=NC2=CC=CC=C2C(=C1)C(=O)/C(=C/C3=CC(=C(C=C3)OC)O)/C |
Computed by PubChem (NCBI)
Synonyms:
Microtubule inhibitor 1, orb1709134