CAS 1456632-46-4 is the registry number for Benzyl 5-Amino-2-(benzyloxy)benzoate. Offered by: TRC. Available pack sizes: 10g.
Benzyl 5-amino-2-phenylmethoxybenzoate (CAS 1456632-46-4) is a chemical compound with the molecular formula C21H19NO3 and a molecular weight of 333.4 g/mol. IUPAC name: benzyl 5-amino-2-phenylmethoxybenzoate. InChIKey: XICZFKDDJLPGJR-UHFFFAOYSA-N.
| Molecular formula | C21H19NO3 |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | benzyl 5-amino-2-phenylmethoxybenzoate |
| InChIKey | XICZFKDDJLPGJR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)N)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)