Products 115029-30-6
CAS 115029-30-6 is the registry number for 5-(2-(Dimethylamino)ethoxy)-9-hydroxy-benzo(c)fluoren-7-one. Offered by: TRC. Available pack sizes: 25mg.
5-[2-(dimethylamino)ethoxy]-9-hydroxybenzo[c]fluoren-7-one (CAS 115029-30-6) is a chemical compound with the molecular formula C21H19NO3 and a molecular weight of 333.4 g/mol. IUPAC name: 5-[2-(dimethylamino)ethoxy]-9-hydroxybenzo[c]fluoren-7-one. InChIKey: SAMGZMAPTSFCLX-UHFFFAOYSA-N.
| Molecular formula | C21H19NO3 |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | 5-[2-(dimethylamino)ethoxy]-9-hydroxybenzo[c]fluoren-7-one |
| InChIKey | SAMGZMAPTSFCLX-UHFFFAOYSA-N |
| SMILES | CN(C)CCOC1=CC2=C(C3=C(C2=O)C=C(C=C3)O)C4=CC=CC=C41 |
Computed by PubChem (NCBI)