CAS 31123-05-4 is the registry number for 3,4-Bis-benzyloxy-benzaldehyde oxime, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(NE)-N-[[3,4-bis(phenylmethoxy)phenyl]methylidene]hydroxylamine (CAS 31123-05-4) is a chemical compound with the molecular formula C21H19NO3 and a molecular weight of 333.4 g/mol. IUPAC name: (NE)-N-[[3,4-bis(phenylmethoxy)phenyl]methylidene]hydroxylamine. InChIKey: BTTPSAYYBOVDKX-HYARGMPZSA-N.
| Molecular formula | C21H19NO3 |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | (NE)-N-[[3,4-bis(phenylmethoxy)phenyl]methylidene]hydroxylamine |
| InChIKey | BTTPSAYYBOVDKX-HYARGMPZSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)/C=N/O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)