cas: 106429-57-6 — see every product listed under this CAS number, including other names
1H-Benzimidazole-5-carboxylic acid, 2,3-dihydro-2-oxo-, methyl ester, 98%, 98% (CAS 106429-57-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1194RB-100mg |
| cas | 106429-57-6 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 227.60 Pln | |
| Chemat | 25g | 813.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-oxo-1,3-dihydrobenzimidazole-5-carboxylate (CAS 106429-57-6) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: methyl 2-oxo-1,3-dihydrobenzimidazole-5-carboxylate. InChIKey: KZBROPAHLBJQQC-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | methyl 2-oxo-1,3-dihydrobenzimidazole-5-carboxylate |
| InChIKey | KZBROPAHLBJQQC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)NC(=O)N2 |
Computed by PubChem (NCBI)