cas: 106429-57-6 — see every product listed under this CAS number, including other names
Methyl 2-oxo-2,3-dihydro-1H-benzo[d]imidazole-5-carboxylate, 98% (CAS 106429-57-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F210162-1G |
| cas | 106429-57-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 268.67 Pln | |
| Fluorochem | 10g | 476.93 Pln | |
| Fluorochem | 25g | 1101.71 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2-oxo-1,3-dihydrobenzimidazole-5-carboxylate (CAS 106429-57-6) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: methyl 2-oxo-1,3-dihydrobenzimidazole-5-carboxylate. InChIKey: KZBROPAHLBJQQC-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | methyl 2-oxo-1,3-dihydrobenzimidazole-5-carboxylate |
| InChIKey | KZBROPAHLBJQQC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)NC(=O)N2 |
Computed by PubChem (NCBI)