cas: 865998-46-5 — see every product listed under this CAS number, including other names
1H-Imidazole-2-carboxylic acid, 5-nitro-, ethyl ester, 98%, 98% (CAS 865998-46-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115U24-100mg |
| cas | 865998-46-5 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 491.60 Pln | |
| Chemat | 10g | 818.00 Pln | |
| Chemat | 25g | 1782.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 5-nitro-1H-imidazole-2-carboxylate (CAS 865998-46-5) is a chemical compound with the molecular formula C6H7N3O4 and a molecular weight of 185.14 g/mol. IUPAC name: ethyl 5-nitro-1H-imidazole-2-carboxylate. InChIKey: YSVPLWXCZZORIO-UHFFFAOYSA-N.
| Molecular formula | C6H7N3O4 |
|---|---|
| Molecular weight | 185.14 g/mol |
| IUPAC name | ethyl 5-nitro-1H-imidazole-2-carboxylate |
| InChIKey | YSVPLWXCZZORIO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC=C(N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)