Products 89946-67-8

CAS 89946-67-8 is the registry number for 3-Methyl-5-nitro-3h-imidazole-4-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 3-methyl-5-nitroimidazole-4-carboxylate (CAS 89946-67-8) is a chemical compound with the molecular formula C6H7N3O4 and a molecular weight of 185.14 g/mol. IUPAC name: methyl 3-methyl-5-nitroimidazole-4-carboxylate. InChIKey: GMPRHTFNNVPEQS-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7N3O4
Molecular weight185.14 g/mol
IUPAC namemethyl 3-methyl-5-nitroimidazole-4-carboxylate
InChIKeyGMPRHTFNNVPEQS-UHFFFAOYSA-N
SMILESCN1C=NC(=C1C(=O)OC)[N+](=O)[O-]

Computed by PubChem (NCBI)