cas: 599183-35-4 — see every product listed under this CAS number, including other names
1H-Indazole-5-sulfonylchloride, 96%, 96% (CAS 599183-35-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1148I4-100mg |
| cas | 599183-35-4 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 736.40 Pln | |
| Chemat | 250mg | 1216.40 Pln | |
| Chemat | 1g | 3030.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
1H-indazole-5-sulfonyl chloride (CAS 599183-35-4) is a chemical compound with the molecular formula C7H5ClN2O2S and a molecular weight of 216.65 g/mol. IUPAC name: 1H-indazole-5-sulfonyl chloride. InChIKey: OHNCNPVNTFTJLX-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O2S |
|---|---|
| Molecular weight | 216.65 g/mol |
| IUPAC name | 1H-indazole-5-sulfonyl chloride |
| InChIKey | OHNCNPVNTFTJLX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1S(=O)(=O)Cl)C=NN2 |
Computed by PubChem (NCBI)