Products 1781848-64-3
CAS 1781848-64-3 is the registry number for 1H-Pyrrolo[2,3-b]pyridine-5-sulfonyl chloride 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
1H-pyrrolo[2,3-b]pyridine-5-sulfonyl chloride (CAS 1781848-64-3) is a chemical compound with the molecular formula C7H5ClN2O2S and a molecular weight of 216.65 g/mol. IUPAC name: 1H-pyrrolo[2,3-b]pyridine-5-sulfonyl chloride. InChIKey: WHSYKGZAIHQKGJ-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O2S |
|---|---|
| Molecular weight | 216.65 g/mol |
| IUPAC name | 1H-pyrrolo[2,3-b]pyridine-5-sulfonyl chloride |
| InChIKey | WHSYKGZAIHQKGJ-UHFFFAOYSA-N |
| SMILES | C1=CNC2=NC=C(C=C21)S(=O)(=O)Cl |
Computed by PubChem (NCBI)