CAS 1152880-25-5 is the registry number for 4-Chloro-3-cyanobenzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-chloro-3-cyanobenzenesulfonamide (CAS 1152880-25-5) is a chemical compound with the molecular formula C7H5ClN2O2S and a molecular weight of 216.65 g/mol. IUPAC name: 4-chloro-3-cyanobenzenesulfonamide. InChIKey: HUDNLOHBEIVPBR-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O2S |
|---|---|
| Molecular weight | 216.65 g/mol |
| IUPAC name | 4-chloro-3-cyanobenzenesulfonamide |
| InChIKey | HUDNLOHBEIVPBR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)N)C#N)Cl |
Computed by PubChem (NCBI)