CAS 1939-76-0 is the registry number for 2-Chloro-5-cyanobenzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-chloro-5-cyanobenzenesulfonamide (CAS 1939-76-0) is a chemical compound with the molecular formula C7H5ClN2O2S and a molecular weight of 216.65 g/mol. IUPAC name: 2-chloro-5-cyanobenzenesulfonamide. InChIKey: UQRASOYVDGPZKP-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O2S |
|---|---|
| Molecular weight | 216.65 g/mol |
| IUPAC name | 2-chloro-5-cyanobenzenesulfonamide |
| InChIKey | UQRASOYVDGPZKP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)S(=O)(=O)N)Cl |
Computed by PubChem (NCBI)