cas: 343-94-2 — see every product listed under this CAS number, including other names
1H-Indole-3-ethanamine, hydrochloride (1:1), 98%, 98% (CAS 343-94-2) is a chemical reagent available from Chemat. Available pack sizes: 50g, 200g, 300g, 400g, 5g, 10g, 25g, 75g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BY9F-50g |
| cas | 343-94-2 |
| size | 50g |
| availability | 2000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 194.00 Pln | |
| Chemat | 200g | 525.20 Pln | |
| Chemat | 300g | 750.80 Pln | |
| Chemat | 400g | 971.60 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 126.80 Pln | |
| Chemat | 75g | 256.40 Pln | |
| Chemat | 100g | 304.40 Pln | |
| Chemat | 500g | 1137.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(1H-indol-3-yl)ethanamine;hydrochloride (CAS 343-94-2) is a chemical compound with the molecular formula C10H13ClN2 and a molecular weight of 196.67 g/mol. IUPAC name: 2-(1H-indol-3-yl)ethanamine;hydrochloride. InChIKey: KDFBGNBTTMPNIG-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2 |
|---|---|
| Molecular weight | 196.67 g/mol |
| IUPAC name | 2-(1H-indol-3-yl)ethanamine;hydrochloride |
| InChIKey | KDFBGNBTTMPNIG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCN.Cl |
Computed by PubChem (NCBI)