cas: 4498-67-3 — see every product listed under this CAS number, including other names
1H-indazole-3-carboxylic acid, 98%, 98% (CAS 4498-67-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 250g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11461Q-5g |
| cas | 4498-67-3 |
| size | 5g |
| availability | 25000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 83.60 Pln | |
| Chemat | 25g | 102.80 Pln | |
| Chemat | 50g | 136.40 Pln | |
| Chemat | 100g | 208.40 Pln | |
| Chemat | 250g | 429.20 Pln | |
| Chemat | 500g | 854.40 Pln | |
| Chemat | 1kg | 1562.00 Pln | |
| Chemat | 5kg | 8001.60 Pln | |
| Chemat | 25kg | price on request |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1H-indazole-3-carboxylic acid (CAS 4498-67-3) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 1H-indazole-3-carboxylic acid. InChIKey: BHXVYTQDWMQVBI-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 1H-indazole-3-carboxylic acid |
| InChIKey | BHXVYTQDWMQVBI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NN2)C(=O)O |
Computed by PubChem (NCBI)