cas: 4498-67-3 — see every product listed under this CAS number, including other names
Indazole-3-carboxylic acid, 97% (CAS 4498-67-3) is a chemical reagent available from Chemat. Available pack sizes: 25g, 50g, 100g, 250g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F790641-25G |
| cas | 4498-67-3 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 128.10 Pln | |
| Fluorochem | 50g | 195.78 Pln | |
| Fluorochem | 100g | 320.74 Pln | |
| Fluorochem | 250g | 664.37 Pln | |
| Fluorochem | 500g | 1143.37 Pln | |
| Fluorochem | 1kg | 2044.09 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
1H-indazole-3-carboxylic acid (CAS 4498-67-3) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 1H-indazole-3-carboxylic acid. InChIKey: BHXVYTQDWMQVBI-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 1H-indazole-3-carboxylic acid |
| InChIKey | BHXVYTQDWMQVBI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NN2)C(=O)O |
Computed by PubChem (NCBI)