cas: 4498-67-3 — see every product listed under this CAS number, including other names
Indazole-3-carboxylic Acid, >98.0%(HPLC)(T) (CAS 4498-67-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | I0672-5G |
| cas | 4498-67-3 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 123.26 Pln | |
| TCI | 25g | 334.70 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
1H-indazole-3-carboxylic acid (CAS 4498-67-3) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 1H-indazole-3-carboxylic acid. InChIKey: BHXVYTQDWMQVBI-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 1H-indazole-3-carboxylic acid |
| InChIKey | BHXVYTQDWMQVBI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NN2)C(=O)O |
Computed by PubChem (NCBI)